C32H36N4 — CID 5380089
2,7,12,17-tetraethyl-3,8,13,18-tetramethylporphyrin (PubChem CID 5380089) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 2,7,12,17-tetraethyl-3,8,13,18-tetramethylporphyrin.
| Compound Name | 2,7,12,17-tetraethyl-3,8,13,18-tetramethylporphyrin |
|---|---|
| PubChem CID | 5380089 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2,7,12,17-tetraethyl-3,8,13,18-tetramethylporphyrin |
| SMILES | CCC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5CC)C(C)=C4CC)C(C)=C3CC |
| InChI | InChI=1S/C32H36N4/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25/h13-16H,9-12H2,1-8H3/b25-14-,26-13-,27-16-,28-15-,29-13-,30-14-,31-15-,32-16- |
| InChIKey | SNWQUGAPELNQRO-GCISPZHASA-N |
| XLogP | 8.26 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |