About [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate
[[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate (PubChem CID 538023) has the molecular formula C18H11Cl2F3N2O2
and a molecular weight of 415.20 g/mol. Its IUPAC name is [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate.
Molecular Properties
| Compound Name | [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate |
| PubChem CID | 538023 |
| Molecular Formula | C18H11Cl2F3N2O2 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate |
| SMILES | CC(=O)OC(c1ccccn1)c1cc(C(F)(F)F)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c1-9(26)27-17(14-4-2-3-5-24-14)12-8-15(18(21,22)23)25-16-11(12)6-10(19)7-13(16)20/h2-8,17H,1H3 |
| InChIKey | CQVLEHUSGFRKMQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate?
The IUPAC name of [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate (CID 538023) is [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate.
What is the SMILES notation for [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate?
The canonical SMILES for [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate is CC(=O)OC(c1ccccn1)c1cc(C(F)(F)F)nc2c(Cl)cc(Cl)cc12.
What is the InChIKey of [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate?
The InChIKey is CQVLEHUSGFRKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2F3N2O2/c1-9(26)27-17(14-4-2-3-5-24-14)12-8-15(18(21,22)23)25-16-11(12)6-10(19)7-13(16)20/h2-8,17H,1H3.
What are the key properties of [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate?
[[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate has a molecular weight of 415.20 g/mol, XLogP of 5.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[6,8-dichloro-2-(trifluoromethyl)quinolin-4-yl]-pyridin-2-ylmethyl] acetate is sourced from PubChem (CID 538023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).