About cyclohex-3-en-1-yl acetate
cyclohex-3-en-1-yl acetate (PubChem CID 538056) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is cyclohex-3-en-1-yl acetate.
Molecular Properties
| Compound Name | cyclohex-3-en-1-yl acetate |
| PubChem CID | 538056 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | cyclohex-3-en-1-yl acetate |
| SMILES | CC(=O)OC1CC=CCC1 |
| InChI | InChI=1S/C8H12O2/c1-7(9)10-8-5-3-2-4-6-8/h2-3,8H,4-6H2,1H3 |
| InChIKey | IIOLXIVFODJEDX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-3-en-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-3-en-1-yl acetate?
The IUPAC name of cyclohex-3-en-1-yl acetate (CID 538056) is cyclohex-3-en-1-yl acetate.
What is the SMILES notation for cyclohex-3-en-1-yl acetate?
The canonical SMILES for cyclohex-3-en-1-yl acetate is CC(=O)OC1CC=CCC1.
What is the InChIKey of cyclohex-3-en-1-yl acetate?
The InChIKey is IIOLXIVFODJEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-7(9)10-8-5-3-2-4-6-8/h2-3,8H,4-6H2,1H3.
What are the key properties of cyclohex-3-en-1-yl acetate?
cyclohex-3-en-1-yl acetate has a molecular weight of 140.18 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-3-en-1-yl acetate is sourced from PubChem (CID 538056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).