About dimethyl (2Z,4E)-hexa-2,4-dienedioate
dimethyl (2Z,4E)-hexa-2,4-dienedioate (PubChem CID 5380594) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is dimethyl (2Z,4E)-hexa-2,4-dienedioate.
Molecular Properties
| Compound Name | dimethyl (2Z,4E)-hexa-2,4-dienedioate |
| PubChem CID | 5380594 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | dimethyl (2Z,4E)-hexa-2,4-dienedioate |
| SMILES | COC(=O)/C=C\C=C\C(=O)OC |
| InChI | InChI=1S/C8H10O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H,1-2H3/b5-3-,6-4+ |
| InChIKey | PXYBXMZVYNWQAM-CIIODKQPSA-N |
| XLogP | 0.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2Z,4E)-hexa-2,4-dienedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2Z,4E)-hexa-2,4-dienedioate?
The IUPAC name of dimethyl (2Z,4E)-hexa-2,4-dienedioate (CID 5380594) is dimethyl (2Z,4E)-hexa-2,4-dienedioate.
What is the SMILES notation for dimethyl (2Z,4E)-hexa-2,4-dienedioate?
The canonical SMILES for dimethyl (2Z,4E)-hexa-2,4-dienedioate is COC(=O)/C=C\C=C\C(=O)OC.
What is the InChIKey of dimethyl (2Z,4E)-hexa-2,4-dienedioate?
The InChIKey is PXYBXMZVYNWQAM-CIIODKQPSA-N. The full InChI is InChI=1S/C8H10O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H,1-2H3/b5-3-,6-4+.
What are the key properties of dimethyl (2Z,4E)-hexa-2,4-dienedioate?
dimethyl (2Z,4E)-hexa-2,4-dienedioate has a molecular weight of 170.16 g/mol, XLogP of 0.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2Z,4E)-hexa-2,4-dienedioate is sourced from PubChem (CID 5380594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).