About (5Z)-5-hexa-2,4-diynylidenefuran-2-one
(5Z)-5-hexa-2,4-diynylidenefuran-2-one (PubChem CID 5380631) has the molecular formula C10H6O2
and a molecular weight of 158.16 g/mol. Its IUPAC name is (5Z)-5-hexa-2,4-diynylidenefuran-2-one.
Molecular Properties
| Compound Name | (5Z)-5-hexa-2,4-diynylidenefuran-2-one |
| PubChem CID | 5380631 |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | (5Z)-5-hexa-2,4-diynylidenefuran-2-one |
| SMILES | CC#CC#C/C=C1/C=CC(=O)O1 |
| InChI | InChI=1S/C10H6O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h6-8H,1H3/b9-6- |
| InChIKey | YOTOGBLIOFSWLS-TWGQIWQCSA-N |
| XLogP | 1.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-hexa-2,4-diynylidenefuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-hexa-2,4-diynylidenefuran-2-one?
The IUPAC name of (5Z)-5-hexa-2,4-diynylidenefuran-2-one (CID 5380631) is (5Z)-5-hexa-2,4-diynylidenefuran-2-one.
What is the SMILES notation for (5Z)-5-hexa-2,4-diynylidenefuran-2-one?
The canonical SMILES for (5Z)-5-hexa-2,4-diynylidenefuran-2-one is CC#CC#C/C=C1/C=CC(=O)O1.
What is the InChIKey of (5Z)-5-hexa-2,4-diynylidenefuran-2-one?
The InChIKey is YOTOGBLIOFSWLS-TWGQIWQCSA-N. The full InChI is InChI=1S/C10H6O2/c1-2-3-4-5-6-9-7-8-10(11)12-9/h6-8H,1H3/b9-6-.
What are the key properties of (5Z)-5-hexa-2,4-diynylidenefuran-2-one?
(5Z)-5-hexa-2,4-diynylidenefuran-2-one has a molecular weight of 158.16 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-hexa-2,4-diynylidenefuran-2-one is sourced from PubChem (CID 5380631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).