About 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 5380710) has the molecular formula C6H3BrClN3
and a molecular weight of 232.47 g/mol. Its IUPAC name is 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine |
| PubChem CID | 5380710 |
| Molecular Formula | C6H3BrClN3 |
| Molecular Weight | 232.47 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncnc2[nH]cc(Br)c12 |
| InChI | InChI=1S/C6H3BrClN3/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H,9,10,11) |
| InChIKey | OXLMTRZWMHIZBY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine (CID 5380710) is 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine is Clc1ncnc2[nH]cc(Br)c12.
What is the InChIKey of 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is OXLMTRZWMHIZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrClN3/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H,9,10,11).
What are the key properties of 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine?
5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 232.47 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 5380710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).