C9H15NO — CID 5380971
(NE)-N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene)hydroxylamine (PubChem CID 5380971) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (NE)-N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5380971 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (NE)-N-(1,2,3,3a,5,6,7,7a-octahydroinden-4-ylidene)hydroxylamine |
| SMILES | O/N=C1\CCCC2CCCC12 |
| InChI | InChI=1S/C9H15NO/c11-10-9-6-2-4-7-3-1-5-8(7)9/h7-8,11H,1-6H2/b10-9+ |
| InChIKey | QNDSJLBANFUPIE-MDZDMXLPSA-N |
| XLogP | 2.42 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|