C9H9NOS — CID 5381005
(NZ)-N-(2,3-dihydrothiochromen-4-ylidene)hydroxylamine (PubChem CID 5381005) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is (NZ)-N-(2,3-dihydrothiochromen-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(2,3-dihydrothiochromen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5381005 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | (NZ)-N-(2,3-dihydrothiochromen-4-ylidene)hydroxylamine |
| SMILES | O/N=C1/CCSc2ccccc21 |
| InChI | InChI=1S/C9H9NOS/c11-10-8-5-6-12-9-4-2-1-3-7(8)9/h1-4,11H,5-6H2/b10-8- |
| InChIKey | RARVWGVWROHFMP-NTMALXAHSA-N |
| XLogP | 2.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|