C18H24O12 — CID 538120
[2-acetyloxy-2-(2,3,4-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-5-yl)ethyl] acetate (PubChem CID 538120) has the molecular formula C18H24O12 and a molecular weight of 432.38 g/mol. Its IUPAC name is [2-acetyloxy-2-(2,3,4-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-5-yl)ethyl] acetate.
| Compound Name | [2-acetyloxy-2-(2,3,4-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-5-yl)ethyl] acetate |
|---|---|
| PubChem CID | 538120 |
| Molecular Formula | C18H24O12 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [2-acetyloxy-2-(2,3,4-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-5-yl)ethyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C12OCC(O1)C(OC(C)=O)C(OC(C)=O)C2OC(C)=O |
| InChI | InChI=1S/C18H24O12/c1-8(19)24-7-14(26-9(2)20)18-17(29-12(5)23)16(28-11(4)22)15(27-10(3)21)13(30-18)6-25-18/h13-17H,6-7H2,1-5H3 |
| InChIKey | XYVNAGKURXMERO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|