About (9Z)-9-hydrazinylidenefluorene-2,5-diamine
(9Z)-9-hydrazinylidenefluorene-2,5-diamine (PubChem CID 5381696) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is (9Z)-9-hydrazinylidenefluorene-2,5-diamine.
Molecular Properties
| Compound Name | (9Z)-9-hydrazinylidenefluorene-2,5-diamine |
| PubChem CID | 5381696 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (9Z)-9-hydrazinylidenefluorene-2,5-diamine |
| SMILES | N/N=C1/c2cc(N)ccc2-c2c(N)cccc21 |
| InChI | InChI=1S/C13H12N4/c14-7-4-5-8-10(6-7)13(17-16)9-2-1-3-11(15)12(8)9/h1-6H,14-16H2/b17-13+ |
| InChIKey | ZPOIFFPDCKXMPW-GHRIWEEISA-N |
| XLogP | 1.54 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (9Z)-9-hydrazinylidenefluorene-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9Z)-9-hydrazinylidenefluorene-2,5-diamine?
The IUPAC name of (9Z)-9-hydrazinylidenefluorene-2,5-diamine (CID 5381696) is (9Z)-9-hydrazinylidenefluorene-2,5-diamine.
What is the SMILES notation for (9Z)-9-hydrazinylidenefluorene-2,5-diamine?
The canonical SMILES for (9Z)-9-hydrazinylidenefluorene-2,5-diamine is N/N=C1/c2cc(N)ccc2-c2c(N)cccc21.
What is the InChIKey of (9Z)-9-hydrazinylidenefluorene-2,5-diamine?
The InChIKey is ZPOIFFPDCKXMPW-GHRIWEEISA-N. The full InChI is InChI=1S/C13H12N4/c14-7-4-5-8-10(6-7)13(17-16)9-2-1-3-11(15)12(8)9/h1-6H,14-16H2/b17-13+.
What are the key properties of (9Z)-9-hydrazinylidenefluorene-2,5-diamine?
(9Z)-9-hydrazinylidenefluorene-2,5-diamine has a molecular weight of 224.27 g/mol, XLogP of 1.54, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9Z)-9-hydrazinylidenefluorene-2,5-diamine is sourced from PubChem (CID 5381696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).