About ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate
ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate (PubChem CID 5381932) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate.
Molecular Properties
| Compound Name | ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate |
| PubChem CID | 5381932 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate |
| SMILES | CCC/C=C(\C)C(C)(C#N)C(=O)OCC |
| InChI | InChI=1S/C12H19NO2/c1-5-7-8-10(3)12(4,9-13)11(14)15-6-2/h8H,5-7H2,1-4H3/b10-8+ |
| InChIKey | AWYSUBWNOACNNC-CSKARUKUSA-N |
| XLogP | 2.83 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate?
The IUPAC name of ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate (CID 5381932) is ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate.
What is the SMILES notation for ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate?
The canonical SMILES for ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate is CCC/C=C(\C)C(C)(C#N)C(=O)OCC.
What is the InChIKey of ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate?
The InChIKey is AWYSUBWNOACNNC-CSKARUKUSA-N. The full InChI is InChI=1S/C12H19NO2/c1-5-7-8-10(3)12(4,9-13)11(14)15-6-2/h8H,5-7H2,1-4H3/b10-8+.
What are the key properties of ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate?
ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate has a molecular weight of 209.29 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-2-cyano-2,3-dimethylhept-3-enoate is sourced from PubChem (CID 5381932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).