C10H6N4O2 — CID 5381995
1,4-dihydropyrazino[2,3-b]quinoxaline-2,3-dione (PubChem CID 5381995) has the molecular formula C10H6N4O2 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1,4-dihydropyrazino[2,3-b]quinoxaline-2,3-dione.
| Compound Name | 1,4-dihydropyrazino[2,3-b]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 5381995 |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1,4-dihydropyrazino[2,3-b]quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2nc3ccccc3nc2[nH]c1=O |
| InChI | InChI=1S/C10H6N4O2/c15-9-10(16)14-8-7(13-9)11-5-3-1-2-4-6(5)12-8/h1-4H,(H,11,13,15)(H,12,14,16) |
| InChIKey | LESSCAUCDFQASR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|