C52H38N4O8 — CID 5382014
methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,24-dihydroporphyrin-5-yl]benzoate (PubChem CID 5382014) has the molecular formula C52H38N4O8 and a molecular weight of 846.90 g/mol. Its IUPAC name is methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,24-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,24-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 5382014 |
| Molecular Formula | C52H38N4O8 |
| Molecular Weight | 846.90 g/mol |
| Exact Mass | 846.27 |
| IUPAC Name | methyl 4-[10,15,20-tris(4-methoxycarbonylphenyl)-21,24-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OC)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc2C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H38N4O8/c1-61-49(57)33-13-5-29(6-14-33)45-37-21-23-39(53-37)46(30-7-15-34(16-8-30)50(58)62-2)41-25-27-43(55-41)48(32-11-19-36(20-12-32)52(60)64-4)44-28-26-42(56-44)47(40-24-22-38(45)54-40)31-9-17-35(18-10-31)51(59)63-3/h5-28,53-54H,1-4H3/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44- |
| InChIKey | JKLAWXSSHNRWMU-PJEPRTEXSA-N |
| XLogP | 10.47 |
| TPSA | 162.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.90 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|