C17H23N3O2 — CID 5382109
(NZ)-N-[(8Z)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine (PubChem CID 5382109) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (NZ)-N-[(8Z)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(8Z)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 5382109 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (NZ)-N-[(8Z)-8-hydroxyimino-3,3,6,6-tetramethyl-2,4,5,7-tetrahydroacridin-1-ylidene]hydroxylamine |
| SMILES | CC1(C)C/C(=N/O)c2cc3c(nc2C1)CC(C)(C)C/C3=N/O |
| InChI | InChI=1S/C17H23N3O2/c1-16(2)6-12-10(14(8-16)19-21)5-11-13(18-12)7-17(3,4)9-15(11)20-22/h5,21-22H,6-9H2,1-4H3/b19-14-,20-15- |
| InChIKey | LINIWRGLYMGZEX-SGAFJUGLSA-N |
| XLogP | 3.38 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|