About 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea
1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea (PubChem CID 5382281) has the molecular formula C7H13N5S
and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea.
Molecular Properties
| Compound Name | 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea |
| PubChem CID | 5382281 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea |
| SMILES | CCCCNC(=S)Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H13N5S/c1-2-3-4-8-7(13)11-6-9-5-10-12-6/h5H,2-4H2,1H3,(H3,8,9,10,11,12,13) |
| InChIKey | RCBZASSKMYWDHW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea?
The IUPAC name of 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea (CID 5382281) is 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea.
What is the SMILES notation for 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea?
The canonical SMILES for 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea is CCCCNC(=S)Nc1ncn[nH]1.
What is the InChIKey of 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea?
The InChIKey is RCBZASSKMYWDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N5S/c1-2-3-4-8-7(13)11-6-9-5-10-12-6/h5H,2-4H2,1H3,(H3,8,9,10,11,12,13).
What are the key properties of 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea?
1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea has a molecular weight of 199.28 g/mol, XLogP of 0.89, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-(1H-1,2,4-triazol-5-yl)thiourea is sourced from PubChem (CID 5382281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).