About penta-1,4-dien-3-yl acetate
penta-1,4-dien-3-yl acetate (PubChem CID 538232) has the molecular formula C7H10O2
and a molecular weight of 126.16 g/mol. Its IUPAC name is penta-1,4-dien-3-yl acetate.
Molecular Properties
| Compound Name | penta-1,4-dien-3-yl acetate |
| PubChem CID | 538232 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | penta-1,4-dien-3-yl acetate |
| SMILES | C=CC(C=C)OC(C)=O |
| InChI | InChI=1S/C7H10O2/c1-4-7(5-2)9-6(3)8/h4-5,7H,1-2H2,3H3 |
| InChIKey | FFCBPQDLWBMDJX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze penta-1,4-dien-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,4-dien-3-yl acetate?
The IUPAC name of penta-1,4-dien-3-yl acetate (CID 538232) is penta-1,4-dien-3-yl acetate.
What is the SMILES notation for penta-1,4-dien-3-yl acetate?
The canonical SMILES for penta-1,4-dien-3-yl acetate is C=CC(C=C)OC(C)=O.
What is the InChIKey of penta-1,4-dien-3-yl acetate?
The InChIKey is FFCBPQDLWBMDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c1-4-7(5-2)9-6(3)8/h4-5,7H,1-2H2,3H3.
What are the key properties of penta-1,4-dien-3-yl acetate?
penta-1,4-dien-3-yl acetate has a molecular weight of 126.16 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,4-dien-3-yl acetate is sourced from PubChem (CID 538232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).