About 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene
2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene (PubChem CID 5382410) has the molecular formula C16H16O2S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene |
| PubChem CID | 5382410 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c1-13-7-6-8-14(2)16(13)11-12-19(17,18)15-9-4-3-5-10-15/h3-12H,1-2H3/b12-11+ |
| InChIKey | UDNISBFLONWFHY-VAWYXSNFSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene?
The IUPAC name of 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene (CID 5382410) is 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene.
What is the SMILES notation for 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene?
The canonical SMILES for 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene is Cc1cccc(C)c1/C=C/S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene?
The InChIKey is UDNISBFLONWFHY-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H16O2S/c1-13-7-6-8-14(2)16(13)11-12-19(17,18)15-9-4-3-5-10-15/h3-12H,1-2H3/b12-11+.
What are the key properties of 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene?
2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene has a molecular weight of 272.37 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(benzenesulfonyl)ethenyl]-1,3-dimethylbenzene is sourced from PubChem (CID 5382410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).