About (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine
(1E)-1-inden-1-ylidene-N,N-dimethylmethanamine (PubChem CID 5382445) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine |
| PubChem CID | 5382445 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine |
| SMILES | CN(C)/C=C1\C=Cc2ccccc21 |
| InChI | InChI=1S/C12H13N/c1-13(2)9-11-8-7-10-5-3-4-6-12(10)11/h3-9H,1-2H3/b11-9+ |
| InChIKey | APROKXRMPOTDTP-PKNBQFBNSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine?
The IUPAC name of (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine (CID 5382445) is (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine.
What is the SMILES notation for (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine?
The canonical SMILES for (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine is CN(C)/C=C1\C=Cc2ccccc21.
What is the InChIKey of (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine?
The InChIKey is APROKXRMPOTDTP-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H13N/c1-13(2)9-11-8-7-10-5-3-4-6-12(10)11/h3-9H,1-2H3/b11-9+.
What are the key properties of (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine?
(1E)-1-inden-1-ylidene-N,N-dimethylmethanamine has a molecular weight of 171.24 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-inden-1-ylidene-N,N-dimethylmethanamine is sourced from PubChem (CID 5382445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).