About CID 5382536
CID 5382536 (PubChem CID 5382536) has the molecular formula C12H8N
and a molecular weight of 166.20 g/mol.
Molecular Properties
| Compound Name | CID 5382536 |
| PubChem CID | 5382536 |
| Molecular Formula | C12H8N |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)[N]c1ccccc1-2 |
| InChI | InChI=1S/C12H8N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H |
| InChIKey | BKRRPNHAJPONSH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5382536 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5382536?
The IUPAC name of CID 5382536 (CID 5382536) is not available.
What is the SMILES notation for CID 5382536?
The canonical SMILES for CID 5382536 is c1ccc2c(c1)[N]c1ccccc1-2.
What is the InChIKey of CID 5382536?
The InChIKey is BKRRPNHAJPONSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H.
What are the key properties of CID 5382536?
CID 5382536 has a molecular weight of 166.20 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5382536 is sourced from PubChem (CID 5382536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).