C16H18O3 — CID 5382640
3-hydroxy-2-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 5382640) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-hydroxy-2-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-hydroxy-2-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 5382640 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 3-hydroxy-2-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CCCc1cc2c3c(c(=O)oc2cc1O)CCCC3 |
| InChI | InChI=1S/C16H18O3/c1-2-5-10-8-13-11-6-3-4-7-12(11)16(18)19-15(13)9-14(10)17/h8-9,17H,2-7H2,1H3 |
| InChIKey | RGEZAAYZWFRNJB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|