C11H17NO — CID 5382663
(NZ)-N-(8a-methyl-2,3,4,4a,5,8-hexahydronaphthalen-1-ylidene)hydroxylamine (PubChem CID 5382663) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (NZ)-N-(8a-methyl-2,3,4,4a,5,8-hexahydronaphthalen-1-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(8a-methyl-2,3,4,4a,5,8-hexahydronaphthalen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5382663 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (NZ)-N-(8a-methyl-2,3,4,4a,5,8-hexahydronaphthalen-1-ylidene)hydroxylamine |
| SMILES | CC12CC=CCC1CCC/C2=N/O |
| InChI | InChI=1S/C11H17NO/c1-11-8-3-2-5-9(11)6-4-7-10(11)12-13/h2-3,9,13H,4-8H2,1H3/b12-10- |
| InChIKey | VSHUNOWSEHQUEE-BENRWUELSA-N |
| XLogP | 2.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|