About (Z)-1,1,4,4-tetramethoxybut-2-ene
(Z)-1,1,4,4-tetramethoxybut-2-ene (PubChem CID 5382783) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is (Z)-1,1,4,4-tetramethoxybut-2-ene.
Molecular Properties
| Compound Name | (Z)-1,1,4,4-tetramethoxybut-2-ene |
| PubChem CID | 5382783 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (Z)-1,1,4,4-tetramethoxybut-2-ene |
| SMILES | COC(/C=C\C(OC)OC)OC |
| InChI | InChI=1S/C8H16O4/c1-9-7(10-2)5-6-8(11-3)12-4/h5-8H,1-4H3/b6-5- |
| InChIKey | ZFGVCDSFRAMNMT-WAYWQWQTSA-N |
| XLogP | 0.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1,4,4-tetramethoxybut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,4,4-tetramethoxybut-2-ene?
The IUPAC name of (Z)-1,1,4,4-tetramethoxybut-2-ene (CID 5382783) is (Z)-1,1,4,4-tetramethoxybut-2-ene.
What is the SMILES notation for (Z)-1,1,4,4-tetramethoxybut-2-ene?
The canonical SMILES for (Z)-1,1,4,4-tetramethoxybut-2-ene is COC(/C=C\C(OC)OC)OC.
What is the InChIKey of (Z)-1,1,4,4-tetramethoxybut-2-ene?
The InChIKey is ZFGVCDSFRAMNMT-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H16O4/c1-9-7(10-2)5-6-8(11-3)12-4/h5-8H,1-4H3/b6-5-.
What are the key properties of (Z)-1,1,4,4-tetramethoxybut-2-ene?
(Z)-1,1,4,4-tetramethoxybut-2-ene has a molecular weight of 176.21 g/mol, XLogP of 0.78, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,4,4-tetramethoxybut-2-ene is sourced from PubChem (CID 5382783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).