About (Z)-2,3-dihydroinden-1-ylidenehydrazine
(Z)-2,3-dihydroinden-1-ylidenehydrazine (PubChem CID 5382905) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is (Z)-2,3-dihydroinden-1-ylidenehydrazine.
Molecular Properties
| Compound Name | (Z)-2,3-dihydroinden-1-ylidenehydrazine |
| PubChem CID | 5382905 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (Z)-2,3-dihydroinden-1-ylidenehydrazine |
| SMILES | N/N=C1/CCc2ccccc21 |
| InChI | InChI=1S/C9H10N2/c10-11-9-6-5-7-3-1-2-4-8(7)9/h1-4H,5-6,10H2/b11-9- |
| InChIKey | ZFFYDQAURJCWPQ-LUAWRHEFSA-N |
| XLogP | 1.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-dihydroinden-1-ylidenehydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-dihydroinden-1-ylidenehydrazine?
The IUPAC name of (Z)-2,3-dihydroinden-1-ylidenehydrazine (CID 5382905) is (Z)-2,3-dihydroinden-1-ylidenehydrazine.
What is the SMILES notation for (Z)-2,3-dihydroinden-1-ylidenehydrazine?
The canonical SMILES for (Z)-2,3-dihydroinden-1-ylidenehydrazine is N/N=C1/CCc2ccccc21.
What is the InChIKey of (Z)-2,3-dihydroinden-1-ylidenehydrazine?
The InChIKey is ZFFYDQAURJCWPQ-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H10N2/c10-11-9-6-5-7-3-1-2-4-8(7)9/h1-4H,5-6,10H2/b11-9-.
What are the key properties of (Z)-2,3-dihydroinden-1-ylidenehydrazine?
(Z)-2,3-dihydroinden-1-ylidenehydrazine has a molecular weight of 146.19 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-dihydroinden-1-ylidenehydrazine is sourced from PubChem (CID 5382905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).