About (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol
(4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol (PubChem CID 5383032) has the molecular formula C9H7F6NO2S
and a molecular weight of 307.22 g/mol. Its IUPAC name is (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol.
Molecular Properties
| Compound Name | (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol |
| PubChem CID | 5383032 |
| Molecular Formula | C9H7F6NO2S |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol |
| SMILES | O/N=C(/CC(O)(C(F)(F)F)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C9H7F6NO2S/c10-8(11,12)7(17,9(13,14)15)4-5(16-18)6-2-1-3-19-6/h1-3,17-18H,4H2/b16-5- |
| InChIKey | ITGUSLGHWMHJRN-BNCCVWRVSA-N |
| XLogP | 3.17 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol?
The IUPAC name of (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol (CID 5383032) is (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol.
What is the SMILES notation for (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol?
The canonical SMILES for (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol is O/N=C(/CC(O)(C(F)(F)F)C(F)(F)F)c1cccs1.
What is the InChIKey of (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol?
The InChIKey is ITGUSLGHWMHJRN-BNCCVWRVSA-N. The full InChI is InChI=1S/C9H7F6NO2S/c10-8(11,12)7(17,9(13,14)15)4-5(16-18)6-2-1-3-19-6/h1-3,17-18H,4H2/b16-5-.
What are the key properties of (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol?
(4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol has a molecular weight of 307.22 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-1,1,1-trifluoro-4-hydroxyimino-4-thiophen-2-yl-2-(trifluoromethyl)butan-2-ol is sourced from PubChem (CID 5383032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).