C11H17N3O5 — CID 5383382
(5Z)-5-[[bis(2-hydroxyethyl)amino]methylidene]-1-ethyl-1,3-diazinane-2,4,6-trione (PubChem CID 5383382) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is (5Z)-5-[[bis(2-hydroxyethyl)amino]methylidene]-1-ethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[bis(2-hydroxyethyl)amino]methylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5383382 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (5Z)-5-[[bis(2-hydroxyethyl)amino]methylidene]-1-ethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)NC(=O)/C(=C/N(CCO)CCO)C1=O |
| InChI | InChI=1S/C11H17N3O5/c1-2-14-10(18)8(9(17)12-11(14)19)7-13(3-5-15)4-6-16/h7,15-16H,2-6H2,1H3,(H,12,17,19)/b8-7- |
| InChIKey | AIUDZUSDESBNDC-FPLPWBNLSA-N |
| XLogP | -1.74 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|