C18H17N3O2 — CID 5383412
(12Z,14Z)-4-phenyl-2,4,6-triazatetracyclo[5.4.4.02,6.08,11]pentadeca-12,14-diene-3,5-dione (PubChem CID 5383412) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (12Z,14Z)-4-phenyl-2,4,6-triazatetracyclo[5.4.4.02,6.08,11]pentadeca-12,14-diene-3,5-dione.
| Compound Name | (12Z,14Z)-4-phenyl-2,4,6-triazatetracyclo[5.4.4.02,6.08,11]pentadeca-12,14-diene-3,5-dione |
|---|---|
| PubChem CID | 5383412 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (12Z,14Z)-4-phenyl-2,4,6-triazatetracyclo[5.4.4.02,6.08,11]pentadeca-12,14-diene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1/C=C\C=C/C2C2CCC21 |
| InChI | InChI=1S/C18H17N3O2/c22-17-19(12-6-2-1-3-7-12)18(23)21-16-9-5-4-8-15(20(17)21)13-10-11-14(13)16/h1-9,13-16H,10-11H2/b8-4-,9-5- |
| InChIKey | ZYBYLKWJSVYPOI-XEQVNJCQSA-N |
| XLogP | 2.05 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |