C20H27NO8S — CID 5383420
methyl 4-[[(2Z)-2-(6,7-dimethoxy-2-methoxysulfonyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetyl]amino]butanoate (PubChem CID 5383420) has the molecular formula C20H27NO8S and a molecular weight of 441.50 g/mol. Its IUPAC name is methyl 4-[[(2Z)-2-(6,7-dimethoxy-2-methoxysulfonyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetyl]amino]butanoate.
| Compound Name | methyl 4-[[(2Z)-2-(6,7-dimethoxy-2-methoxysulfonyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 5383420 |
| Molecular Formula | C20H27NO8S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl 4-[[(2Z)-2-(6,7-dimethoxy-2-methoxysulfonyl-3,4-dihydro-2H-naphthalen-1-ylidene)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)/C=C1/c2cc(OC)c(OC)cc2CCC1S(=O)(=O)OC |
| InChI | InChI=1S/C20H27NO8S/c1-26-16-10-13-7-8-18(30(24,25)29-4)15(14(13)11-17(16)27-2)12-19(22)21-9-5-6-20(23)28-3/h10-12,18H,5-9H2,1-4H3,(H,21,22)/b15-12- |
| InChIKey | BSUFGTQIKKYHBU-QINSGFPZSA-N |
| XLogP | 1.45 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|