C19H19NO5 — CID 5383421
(NZ)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine (PubChem CID 5383421) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (NZ)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 5383421 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (NZ)-N-[6-(3,4-dimethoxyphenyl)-7,8-dihydro-6H-benzo[f][1,3]benzodioxol-5-ylidene]hydroxylamine |
| SMILES | COc1ccc(C2CCc3cc4c(cc3/C2=N\O)OCO4)cc1OC |
| InChI | InChI=1S/C19H19NO5/c1-22-15-6-4-11(7-16(15)23-2)13-5-3-12-8-17-18(25-10-24-17)9-14(12)19(13)20-21/h4,6-9,13,21H,3,5,10H2,1-2H3/b20-19- |
| InChIKey | JQEHLDMXRJMVNO-VXPUYCOJSA-N |
| XLogP | 3.34 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|