C18H24F4O3 — CID 53839832
2-Methoxy-5-trifluoromethyl-6-(9'-fluorodecyl)-1,4-benzoquinone (PubChem CID 53839832) has the molecular formula C18H24F4O3 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-(9-fluorodecyl)-5-methoxy-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-Methoxy-5-trifluoromethyl-6-(9'-fluorodecyl)-1,4-benzoquinone |
|---|---|
| PubChem CID | 53839832 |
| Molecular Formula | C18H24F4O3 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 3-(9-fluorodecyl)-5-methoxy-2-(trifluoromethyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(CCCCCCCCC1=C(C(=O)C=C(C1=O)OC)C(F)(F)F)F |
| InChI | InChI=1S/C18H24F4O3/c1-12(19)9-7-5-3-4-6-8-10-13-16(18(20,21)22)14(23)11-15(25-2)17(13)24/h11-12H,3-10H2,1-2H3 |
| InChIKey | GIHDUFVFHJDMME-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | 547 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|