C20H32 — CID 5384142
(1E,4E,8E,12E)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene (PubChem CID 5384142) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1E,4E,8E,12E)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene.
| Compound Name | (1E,4E,8E,12E)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
|---|---|
| PubChem CID | 5384142 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1E,4E,8E,12E)-2,6,6,9,13-pentamethylcyclopentadeca-1,4,8,12-tetraene |
| SMILES | C/C1=C\CC/C(C)=C/CC/C(C)=C/CC(C)(C)/C=C/C1 |
| InChI | InChI=1S/C20H32/c1-17-9-6-11-18(2)13-8-15-20(4,5)16-14-19(3)12-7-10-17/h8,10-11,14-15H,6-7,9,12-13,16H2,1-5H3/b15-8+,17-10+,18-11+,19-14+ |
| InChIKey | SPMBDLTUBLYRCT-FGMOVADPSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|