About (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate
(Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate (PubChem CID 5384150) has the molecular formula C20H25NO8
and a molecular weight of 407.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate |
| PubChem CID | 5384150 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OC1CCN(C(C)C)C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H21NO4.C4H4O4/c1-11(2)17-9-8-13(10-17)21-16(19)14-6-4-5-7-15(14)20-12(3)18;5-3(6)1-2-4(7)8/h4-7,11,13H,8-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FEXAKSNSCLUYAU-BTJKTKAUSA-N |
| XLogP | 1.96 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate?
The IUPAC name of (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate (CID 5384150) is (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate.
What is the SMILES notation for (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate?
The canonical SMILES for (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OC1CCN(C(C)C)C1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate?
The InChIKey is FEXAKSNSCLUYAU-BTJKTKAUSA-N. The full InChI is InChI=1S/C16H21NO4.C4H4O4/c1-11(2)17-9-8-13(10-17)21-16(19)14-6-4-5-7-15(14)20-12(3)18;5-3(6)1-2-4(7)8/h4-7,11,13H,8-10H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate?
(Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate has a molecular weight of 407.42 g/mol, XLogP of 1.96, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;(1-propan-2-ylpyrrolidin-3-yl) 2-acetyloxybenzoate is sourced from PubChem (CID 5384150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).