C19H16FNO3 — CID 5384552
9-fluoro-6-hydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one (PubChem CID 5384552) has the molecular formula C19H16FNO3 and a molecular weight of 325.34 g/mol. Its IUPAC name is 9-fluoro-6-hydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one.
| Compound Name | 9-fluoro-6-hydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 5384552 |
| Molecular Formula | C19H16FNO3 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 9-fluoro-6-hydroxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
| SMILES | Cn1c2ccc(F)cc2c(=O)c2c(O)cc3c(c21)C=CC(C)(C)O3 |
| InChI | InChI=1S/C19H16FNO3/c1-19(2)7-6-11-15(24-19)9-14(22)16-17(11)21(3)13-5-4-10(20)8-12(13)18(16)23/h4-9,22H,1-3H3 |
| InChIKey | GIVUUDRTICQXIC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|