About (E)-1,3-dihydroxydec-8-en-5-one
(E)-1,3-dihydroxydec-8-en-5-one (PubChem CID 5384628) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (E)-1,3-dihydroxydec-8-en-5-one.
Molecular Properties
| Compound Name | (E)-1,3-dihydroxydec-8-en-5-one |
| PubChem CID | 5384628 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (E)-1,3-dihydroxydec-8-en-5-one |
| SMILES | C/C=C/CCC(=O)CC(O)CCO |
| InChI | InChI=1S/C10H18O3/c1-2-3-4-5-9(12)8-10(13)6-7-11/h2-3,10-11,13H,4-8H2,1H3/b3-2+ |
| InChIKey | SHHVNLZCXWAKNG-NSCUHMNNSA-N |
| XLogP | 1.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,3-dihydroxydec-8-en-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,3-dihydroxydec-8-en-5-one?
The IUPAC name of (E)-1,3-dihydroxydec-8-en-5-one (CID 5384628) is (E)-1,3-dihydroxydec-8-en-5-one.
What is the SMILES notation for (E)-1,3-dihydroxydec-8-en-5-one?
The canonical SMILES for (E)-1,3-dihydroxydec-8-en-5-one is C/C=C/CCC(=O)CC(O)CCO.
What is the InChIKey of (E)-1,3-dihydroxydec-8-en-5-one?
The InChIKey is SHHVNLZCXWAKNG-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H18O3/c1-2-3-4-5-9(12)8-10(13)6-7-11/h2-3,10-11,13H,4-8H2,1H3/b3-2+.
What are the key properties of (E)-1,3-dihydroxydec-8-en-5-one?
(E)-1,3-dihydroxydec-8-en-5-one has a molecular weight of 186.25 g/mol, XLogP of 1.05, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,3-dihydroxydec-8-en-5-one is sourced from PubChem (CID 5384628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).