C34H34N2O6 — CID 5385085
(7Z,20Z)-12,25-dimethoxy-8,21-diphenyl-2,6,15,19-tetraoxa-7,20-diazatricyclo[20.4.0.09,14]hexacosa-1(22),7,9(14),10,12,20,23,25-octaene (PubChem CID 5385085) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is (7Z,20Z)-12,25-dimethoxy-8,21-diphenyl-2,6,15,19-tetraoxa-7,20-diazatricyclo[20.4.0.09,14]hexacosa-1(22),7,9(14),10,12,20,23,25-octaene.
| Compound Name | (7Z,20Z)-12,25-dimethoxy-8,21-diphenyl-2,6,15,19-tetraoxa-7,20-diazatricyclo[20.4.0.09,14]hexacosa-1(22),7,9(14),10,12,20,23,25-octaene |
|---|---|
| PubChem CID | 5385085 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (7Z,20Z)-12,25-dimethoxy-8,21-diphenyl-2,6,15,19-tetraoxa-7,20-diazatricyclo[20.4.0.09,14]hexacosa-1(22),7,9(14),10,12,20,23,25-octaene |
| SMILES | COc1ccc2c(c1)OCCCO/N=C(\c1ccccc1)c1ccc(OC)cc1OCCCO/N=C/2c1ccccc1 |
| InChI | InChI=1S/C34H34N2O6/c1-37-27-15-17-29-31(23-27)39-19-9-21-42-36-34(26-13-7-4-8-14-26)30-18-16-28(38-2)24-32(30)40-20-10-22-41-35-33(29)25-11-5-3-6-12-25/h3-8,11-18,23-24H,9-10,19-22H2,1-2H3/b35-33+,36-34+ |
| InChIKey | YRGGQYPLKVORQV-LBYUQGKWSA-N |
| XLogP | 6.49 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |