About [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate
[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate (PubChem CID 5385498) has the molecular formula C24H44O6
and a molecular weight of 428.61 g/mol. Its IUPAC name is [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate |
| PubChem CID | 5385498 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C24H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3/b10-9+ |
| InChIKey | NWGKJDSIEKMTRX-MDZDMXLPSA-N |
| XLogP | 4.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate?
The IUPAC name of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate (CID 5385498) is [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate.
What is the SMILES notation for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate?
The canonical SMILES for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OCC(O)C1OCC(O)C1O.
What is the InChIKey of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate?
The InChIKey is NWGKJDSIEKMTRX-MDZDMXLPSA-N. The full InChI is InChI=1S/C24H44O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-19-21(26)24-23(28)20(25)18-30-24/h9-10,20-21,23-26,28H,2-8,11-19H2,1H3/b10-9+.
What are the key properties of [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate?
[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate has a molecular weight of 428.61 g/mol, XLogP of 4.05, 18 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] (E)-octadec-9-enoate is sourced from PubChem (CID 5385498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).