About butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate
butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate (PubChem CID 5385691) has the molecular formula C26H40N2O2
and a molecular weight of 412.62 g/mol. Its IUPAC name is butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate.
Molecular Properties
| Compound Name | butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate |
| PubChem CID | 5385691 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate |
| SMILES | CCCCOC(=O)CCCCCCC/C=C/C1C=CC(CCCC)C(C#N)C1C#N |
| InChI | InChI=1S/C26H40N2O2/c1-3-5-14-22-17-18-23(25(21-28)24(22)20-27)15-12-10-8-7-9-11-13-16-26(29)30-19-6-4-2/h12,15,17-18,22-25H,3-11,13-14,16,19H2,1-2H3/b15-12+ |
| InChIKey | OUCFEMDIOMPJEK-NTCAYCPXSA-N |
| XLogP | 6.89 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate?
The IUPAC name of butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate (CID 5385691) is butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate.
What is the SMILES notation for butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate?
The canonical SMILES for butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate is CCCCOC(=O)CCCCCCC/C=C/C1C=CC(CCCC)C(C#N)C1C#N.
What is the InChIKey of butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate?
The InChIKey is OUCFEMDIOMPJEK-NTCAYCPXSA-N. The full InChI is InChI=1S/C26H40N2O2/c1-3-5-14-22-17-18-23(25(21-28)24(22)20-27)15-12-10-8-7-9-11-13-16-26(29)30-19-6-4-2/h12,15,17-18,22-25H,3-11,13-14,16,19H2,1-2H3/b15-12+.
What are the key properties of butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate?
butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate has a molecular weight of 412.62 g/mol, XLogP of 6.89, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (E)-10-(4-butyl-5,6-dicyanocyclohex-2-en-1-yl)dec-9-enoate is sourced from PubChem (CID 5385691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).