About methyl 8-oxononanoate
methyl 8-oxononanoate (PubChem CID 538606) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 8-oxononanoate.
Molecular Properties
| Compound Name | methyl 8-oxononanoate |
| PubChem CID | 538606 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | methyl 8-oxononanoate |
| SMILES | COC(=O)CCCCCCC(C)=O |
| InChI | InChI=1S/C10H18O3/c1-9(11)7-5-3-4-6-8-10(12)13-2/h3-8H2,1-2H3 |
| InChIKey | VEGNIXGAQNVYTP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-oxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-oxononanoate?
The IUPAC name of methyl 8-oxononanoate (CID 538606) is methyl 8-oxononanoate.
What is the SMILES notation for methyl 8-oxononanoate?
The canonical SMILES for methyl 8-oxononanoate is COC(=O)CCCCCCC(C)=O.
What is the InChIKey of methyl 8-oxononanoate?
The InChIKey is VEGNIXGAQNVYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-9(11)7-5-3-4-6-8-10(12)13-2/h3-8H2,1-2H3.
What are the key properties of methyl 8-oxononanoate?
methyl 8-oxononanoate has a molecular weight of 186.25 g/mol, XLogP of 2.09, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxononanoate is sourced from PubChem (CID 538606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).