C14H18Cl6N2O2 — CID 5386365
(6E)-1,4-dimethyl-3-(3,3,3-trichloro-2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropylidene)piperazine-2,5-dione (PubChem CID 5386365) has the molecular formula C14H18Cl6N2O2 and a molecular weight of 459.03 g/mol. Its IUPAC name is (6E)-1,4-dimethyl-3-(3,3,3-trichloro-2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropylidene)piperazine-2,5-dione.
| Compound Name | (6E)-1,4-dimethyl-3-(3,3,3-trichloro-2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 5386365 |
| Molecular Formula | C14H18Cl6N2O2 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | (6E)-1,4-dimethyl-3-(3,3,3-trichloro-2-methylpropyl)-6-(3,3,3-trichloro-2-methylpropylidene)piperazine-2,5-dione |
| SMILES | CC(/C=C1\C(=O)N(C)C(CC(C)C(Cl)(Cl)Cl)C(=O)N1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl6N2O2/c1-7(13(15,16)17)5-9-11(23)22(4)10(12(24)21(9)3)6-8(2)14(18,19)20/h5,7-8,10H,6H2,1-4H3/b9-5+ |
| InChIKey | XJCMCNILUZGERI-WEVVVXLNSA-N |
| XLogP | 4.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|