C14H7F6NO2 — CID 5386487
(Z)-1,1,1,5,5,5-hexafluoro-3-isoquinolin-2-ium-2-yl-4-oxopent-2-en-2-olate (PubChem CID 5386487) has the molecular formula C14H7F6NO2 and a molecular weight of 335.20 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-3-isoquinolin-2-ium-2-yl-4-oxopent-2-en-2-olate.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-3-isoquinolin-2-ium-2-yl-4-oxopent-2-en-2-olate |
|---|---|
| PubChem CID | 5386487 |
| Molecular Formula | C14H7F6NO2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-3-isoquinolin-2-ium-2-yl-4-oxopent-2-en-2-olate |
| SMILES | O=C(/C(=C(/[O-])C(F)(F)F)[n+]1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C14H7F6NO2/c15-13(16,17)11(22)10(12(23)14(18,19)20)21-6-5-8-3-1-2-4-9(8)7-21/h1-7H |
| InChIKey | IGQGMNYYJDQEEU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|