About 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate
1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate (PubChem CID 5386766) has the molecular formula C17H20O4S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate |
| PubChem CID | 5386766 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate |
| SMILES | COC(=O)C(=C\Sc1ccccc1)/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20O4S/c1-17(2,3)21-15(18)11-10-13(16(19)20-4)12-22-14-8-6-5-7-9-14/h5-12H,1-4H3/b11-10+,13-12- |
| InChIKey | YXGNXJVHYJIRTR-MRBUWEIXSA-N |
| XLogP | 3.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate?
The IUPAC name of 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate (CID 5386766) is 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate is COC(=O)C(=C\Sc1ccccc1)/C=C/C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate?
The InChIKey is YXGNXJVHYJIRTR-MRBUWEIXSA-N. The full InChI is InChI=1S/C17H20O4S/c1-17(2,3)21-15(18)11-10-13(16(19)20-4)12-22-14-8-6-5-7-9-14/h5-12H,1-4H3/b11-10+,13-12-.
What are the key properties of 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate?
1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate has a molecular weight of 320.41 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-methyl (E,4Z)-4-(phenylsulfanylmethylidene)pent-2-enedioate is sourced from PubChem (CID 5386766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).