C19H30N2Si — CID 5386775
[(Z)-5-(2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-1-yl)pent-2-en-3-yl]-trimethylsilane (PubChem CID 5386775) has the molecular formula C19H30N2Si and a molecular weight of 314.55 g/mol. Its IUPAC name is [(Z)-5-(2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-1-yl)pent-2-en-3-yl]-trimethylsilane.
| Compound Name | [(Z)-5-(2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-1-yl)pent-2-en-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 5386775 |
| Molecular Formula | C19H30N2Si |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | [(Z)-5-(2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-1-yl)pent-2-en-3-yl]-trimethylsilane |
| SMILES | C/C=C(/CCC1NCCC2c3ccccc3NC12)[Si](C)(C)C |
| InChI | InChI=1S/C19H30N2Si/c1-5-14(22(2,3)4)10-11-18-19-16(12-13-20-18)15-8-6-7-9-17(15)21-19/h5-9,16,18-21H,10-13H2,1-4H3/b14-5- |
| InChIKey | NSHWEQKTJYYKNJ-RZNTYIFUSA-N |
| XLogP | 4.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|