C21H23NO2 — CID 5386799
(E)-5-morpholin-4-yl-1,2-diphenylpent-1-en-3-one (PubChem CID 5386799) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-5-morpholin-4-yl-1,2-diphenylpent-1-en-3-one.
| Compound Name | (E)-5-morpholin-4-yl-1,2-diphenylpent-1-en-3-one |
|---|---|
| PubChem CID | 5386799 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-5-morpholin-4-yl-1,2-diphenylpent-1-en-3-one |
| SMILES | O=C(CCN1CCOCC1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c23-21(11-12-22-13-15-24-16-14-22)20(19-9-5-2-6-10-19)17-18-7-3-1-4-8-18/h1-10,17H,11-16H2/b20-17+ |
| InChIKey | JYGSGXREECBQGN-LVZFUZTISA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|