C24H37NO2S — CID 5386821
N-[4-tert-butyl-1-[(1E,3Z)-hepta-1,3-dienyl]cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 5386821) has the molecular formula C24H37NO2S and a molecular weight of 403.63 g/mol. Its IUPAC name is N-[4-tert-butyl-1-[(1E,3Z)-hepta-1,3-dienyl]cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-tert-butyl-1-[(1E,3Z)-hepta-1,3-dienyl]cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5386821 |
| Molecular Formula | C24H37NO2S |
| Molecular Weight | 403.63 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | N-[4-tert-butyl-1-[(1E,3Z)-hepta-1,3-dienyl]cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | CCC/C=C\C=C\C1(NS(=O)(=O)c2ccc(C)cc2)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37NO2S/c1-6-7-8-9-10-17-24(18-15-21(16-19-24)23(3,4)5)25-28(26,27)22-13-11-20(2)12-14-22/h8-14,17,21,25H,6-7,15-16,18-19H2,1-5H3/b9-8-,17-10+ |
| InChIKey | VUDALRJANQXYOU-ABHVWSBLSA-N |
| XLogP | 6.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.63 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|