C13H22O6 — CID 538702
2-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)ethyl acetate (PubChem CID 538702) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)ethyl acetate.
| Compound Name | 2-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)ethyl acetate |
|---|---|
| PubChem CID | 538702 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(7-hydroxy-2,2,7-trimethyl-3a,4,6,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1OCC(C)(O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C13H22O6/c1-8(14)16-6-5-9-10-11(13(4,15)7-17-9)19-12(2,3)18-10/h9-11,15H,5-7H2,1-4H3 |
| InChIKey | RMAMMZWJJHQNPC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |