C23H27N3O — CID 5387024
(3E,5E)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one (PubChem CID 5387024) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 5387024 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (3E,5E)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\CNC/C(=C\c3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O/c1-25(2)21-9-5-17(6-10-21)13-19-15-24-16-20(23(19)27)14-18-7-11-22(12-8-18)26(3)4/h5-14,24H,15-16H2,1-4H3/b19-13+,20-14+ |
| InChIKey | PQXIGFCAMSKVHL-IWGRKNQJSA-N |
| XLogP | 3.46 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|