C18H28O4 — CID 5387047
[(5E)-4-acetyloxy-6,10-dimethyl-2-methylideneundeca-5,9-dienyl] acetate (PubChem CID 5387047) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(5E)-4-acetyloxy-6,10-dimethyl-2-methylideneundeca-5,9-dienyl] acetate.
| Compound Name | [(5E)-4-acetyloxy-6,10-dimethyl-2-methylideneundeca-5,9-dienyl] acetate |
|---|---|
| PubChem CID | 5387047 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | [(5E)-4-acetyloxy-6,10-dimethyl-2-methylideneundeca-5,9-dienyl] acetate |
| SMILES | C=C(COC(C)=O)CC(/C=C(\C)CCC=C(C)C)OC(C)=O |
| InChI | InChI=1S/C18H28O4/c1-13(2)8-7-9-14(3)10-18(22-17(6)20)11-15(4)12-21-16(5)19/h8,10,18H,4,7,9,11-12H2,1-3,5-6H3/b14-10+ |
| InChIKey | ZAXYWVMAJQQJNL-GXDHUFHOSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|