About tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane
tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane (PubChem CID 5387051) has the molecular formula C15H30OSi
and a molecular weight of 254.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane |
| PubChem CID | 5387051 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane |
| SMILES | C/C=C(\C)CC/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-8-14(2)12-10-9-11-13-16-17(6,7)15(3,4)5/h8-9,11H,10,12-13H2,1-7H3/b11-9+,14-8+ |
| InChIKey | PCZNVUJKDMKJJL-NKLYCRJGSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane (CID 5387051) is tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane is C/C=C(\C)CC/C=C/CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane?
The InChIKey is PCZNVUJKDMKJJL-NKLYCRJGSA-N. The full InChI is InChI=1S/C15H30OSi/c1-8-14(2)12-10-9-11-13-16-17(6,7)15(3,4)5/h8-9,11H,10,12-13H2,1-7H3/b11-9+,14-8+.
What are the key properties of tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane?
tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane has a molecular weight of 254.49 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(2E,6E)-6-methylocta-2,6-dienoxy]silane is sourced from PubChem (CID 5387051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).