About methyl N-acetylethanimidate
methyl N-acetylethanimidate (PubChem CID 538714) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is methyl N-acetylethanimidate.
Molecular Properties
| Compound Name | methyl N-acetylethanimidate |
| PubChem CID | 538714 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | methyl N-acetylethanimidate |
| SMILES | CO/C(C)=N/C(C)=O |
| InChI | InChI=1S/C5H9NO2/c1-4(7)6-5(2)8-3/h1-3H3/b6-5+ |
| InChIKey | CXWBRDHRHGQVGY-AATRIKPKSA-N |
| XLogP | 0.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-acetylethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-acetylethanimidate?
The IUPAC name of methyl N-acetylethanimidate (CID 538714) is methyl N-acetylethanimidate.
What is the SMILES notation for methyl N-acetylethanimidate?
The canonical SMILES for methyl N-acetylethanimidate is CO/C(C)=N/C(C)=O.
What is the InChIKey of methyl N-acetylethanimidate?
The InChIKey is CXWBRDHRHGQVGY-AATRIKPKSA-N. The full InChI is InChI=1S/C5H9NO2/c1-4(7)6-5(2)8-3/h1-3H3/b6-5+.
What are the key properties of methyl N-acetylethanimidate?
methyl N-acetylethanimidate has a molecular weight of 115.13 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-acetylethanimidate is sourced from PubChem (CID 538714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).