C24H38O5 — CID 5387256
[(3aR,4E,8E)-1-(2-acetyloxypropan-2-yl)-10-hydroxy-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate (PubChem CID 5387256) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(3aR,4E,8E)-1-(2-acetyloxypropan-2-yl)-10-hydroxy-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate.
| Compound Name | [(3aR,4E,8E)-1-(2-acetyloxypropan-2-yl)-10-hydroxy-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate |
|---|---|
| PubChem CID | 5387256 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(3aR,4E,8E)-1-(2-acetyloxypropan-2-yl)-10-hydroxy-3a,6,10-trimethyl-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(O)/C=C/CC(C)/C=C/[C@@]2(C)CCC(C(C)(C)OC(C)=O)C12 |
| InChI | InChI=1S/C24H38O5/c1-16-9-8-12-24(7,27)15-20(28-17(2)25)21-19(22(4,5)29-18(3)26)11-14-23(21,6)13-10-16/h8,10,12-13,16,19-21,27H,9,11,14-15H2,1-7H3/b12-8+,13-10+/t16?,19?,20?,21?,23-,24?/m0/s1 |
| InChIKey | JRJQERYJSFEBBL-JPCAYNDJSA-N |
| XLogP | 4.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|