C16H27NO — CID 5387261
N-[1-methyl-4-[(2E,4E)-6-methylhepta-2,4-dien-2-yl]cyclohexyl]formamide (PubChem CID 5387261) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[1-methyl-4-[(2E,4E)-6-methylhepta-2,4-dien-2-yl]cyclohexyl]formamide.
| Compound Name | N-[1-methyl-4-[(2E,4E)-6-methylhepta-2,4-dien-2-yl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 5387261 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[1-methyl-4-[(2E,4E)-6-methylhepta-2,4-dien-2-yl]cyclohexyl]formamide |
| SMILES | C/C(=C\C=C\C(C)C)C1CCC(C)(NC=O)CC1 |
| InChI | InChI=1S/C16H27NO/c1-13(2)6-5-7-14(3)15-8-10-16(4,11-9-15)17-12-18/h5-7,12-13,15H,8-11H2,1-4H3,(H,17,18)/b6-5+,14-7+ |
| InChIKey | UTOXGRXZEVOUFE-AVJLEEFCSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|